About 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol
2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol (PubChem CID 171613697) has the molecular formula C18H26BrFN2O3
and a molecular weight of 417.32 g/mol. Its IUPAC name is 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol.
Molecular Properties
| Compound Name | 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol |
| PubChem CID | 171613697 |
| Molecular Formula | C18H26BrFN2O3 |
| Molecular Weight | 417.32 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol |
| SMILES | CCC(CO)c1c(F)cc2c(cnn2C2CCCCO2)c1Br.CCO |
| InChI | InChI=1S/C16H20BrFN2O2.C2H6O/c1-2-10(9-21)15-12(18)7-13-11(16(15)17)8-19-20(13)14-5-3-4-6-22-14;1-2-3/h7-8,10,14,21H,2-6,9H2,1H3;3H,2H2,1H3 |
| InChIKey | BENJCDWYQFJQAX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol?
The IUPAC name of 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol (CID 171613697) is 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol.
What is the SMILES notation for 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol?
The canonical SMILES for 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol is CCC(CO)c1c(F)cc2c(cnn2C2CCCCO2)c1Br.CCO.
What is the InChIKey of 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol?
The InChIKey is BENJCDWYQFJQAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20BrFN2O2.C2H6O/c1-2-10(9-21)15-12(18)7-13-11(16(15)17)8-19-20(13)14-5-3-4-6-22-14;1-2-3/h7-8,10,14,21H,2-6,9H2,1H3;3H,2H2,1H3.
What are the key properties of 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol?
2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol has a molecular weight of 417.32 g/mol, XLogP of 4.12, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-bromo-6-fluoro-1-(oxan-2-yl)indazol-5-yl]butan-1-ol;ethanol is sourced from PubChem (CID 171613697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).