C22H28BFO4 — CID 171613720
ethyl 4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate (PubChem CID 171613720) has the molecular formula C22H28BFO4 and a molecular weight of 386.27 g/mol. Its IUPAC name is ethyl 4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate.
| Compound Name | ethyl 4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate |
|---|---|
| PubChem CID | 171613720 |
| Molecular Formula | C22H28BFO4 |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | ethyl 4-[2-fluoro-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]butanoate |
| SMILES | CCOC(=O)CCCc1c(F)ccc2cccc(B3OC(C)(C)C(C)(C)O3)c12 |
| InChI | InChI=1S/C22H28BFO4/c1-6-26-19(25)12-8-10-16-18(24)14-13-15-9-7-11-17(20(15)16)23-27-21(2,3)22(4,5)28-23/h7,9,11,13-14H,6,8,10,12H2,1-5H3 |
| InChIKey | PFZXWJJKIPISCM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|