C20H17F10N3O5S — CID 171613870
[6-[(2R,3S,4S,5R)-2-[[1-(difluoromethyl)-3-methylpyrazol-4-yl]carbamoyl]-4,5-dimethyl-5-(trifluoromethyl)oxolan-3-yl]-2,3-difluorophenyl] trifluoromethanesulfonate (PubChem CID 171613870) has the molecular formula C20H17F10N3O5S and a molecular weight of 601.42 g/mol. Its IUPAC name is [6-[(2R,3S,4S,5R)-2-[[1-(difluoromethyl)-3-methylpyrazol-4-yl]carbamoyl]-4,5-dimethyl-5-(trifluoromethyl)oxolan-3-yl]-2,3-difluorophenyl] trifluoromethanesulfonate.
| Compound Name | [6-[(2R,3S,4S,5R)-2-[[1-(difluoromethyl)-3-methylpyrazol-4-yl]carbamoyl]-4,5-dimethyl-5-(trifluoromethyl)oxolan-3-yl]-2,3-difluorophenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 171613870 |
| Molecular Formula | C20H17F10N3O5S |
| Molecular Weight | 601.42 g/mol |
| Exact Mass | 601.07 |
| IUPAC Name | [6-[(2R,3S,4S,5R)-2-[[1-(difluoromethyl)-3-methylpyrazol-4-yl]carbamoyl]-4,5-dimethyl-5-(trifluoromethyl)oxolan-3-yl]-2,3-difluorophenyl] trifluoromethanesulfonate |
| SMILES | Cc1nn(C(F)F)cc1NC(=O)[C@@H]1O[C@@](C)(C(F)(F)F)[C@@H](C)[C@H]1c1ccc(F)c(F)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H17F10N3O5S/c1-7-12(9-4-5-10(21)13(22)14(9)38-39(35,36)20(28,29)30)15(37-18(7,3)19(25,26)27)16(34)31-11-6-33(17(23)24)32-8(11)2/h4-7,12,15,17H,1-3H3,(H,31,34)/t7-,12-,15+,18+/m0/s1 |
| InChIKey | NGWOFYAVZVBIBT-VQLHIYHQSA-N |
| XLogP | 5.17 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|