C16H21N3O7 — CID 171613976
4-[bis[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]-4-oxobutanoic acid (PubChem CID 171613976) has the molecular formula C16H21N3O7 and a molecular weight of 367.36 g/mol. Its IUPAC name is 4-[bis[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[bis[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 171613976 |
| Molecular Formula | C16H21N3O7 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4-[bis[2-(2,5-dioxopyrrolidin-1-yl)ethyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(CCN1C(=O)CCC1=O)CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C16H21N3O7/c20-11(5-6-16(25)26)17(7-9-18-12(21)1-2-13(18)22)8-10-19-14(23)3-4-15(19)24/h1-10H2,(H,25,26) |
| InChIKey | AXDZJHVXTXFIBB-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|