About 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one
7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one (PubChem CID 171614035) has the molecular formula C24H20Cl2N2O4
and a molecular weight of 471.34 g/mol. Its IUPAC name is 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one.
Molecular Properties
| Compound Name | 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one |
| PubChem CID | 171614035 |
| Molecular Formula | C24H20Cl2N2O4 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one |
| SMILES | O=c1[nH]c2cc(CCl)ccc2c2c1COC2.O=c1[nH]c2cc(CCl)ccc2c2c1COC2 |
| InChI | InChI=1S/2C12H10ClNO2/c2*13-4-7-1-2-8-9-5-16-6-10(9)12(15)14-11(8)3-7/h2*1-3H,4-6H2,(H,14,15) |
| InChIKey | VTKJFIWYSUBHNP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one?
The IUPAC name of 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one (CID 171614035) is 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one.
What is the SMILES notation for 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one?
The canonical SMILES for 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one is O=c1[nH]c2cc(CCl)ccc2c2c1COC2.O=c1[nH]c2cc(CCl)ccc2c2c1COC2.
What is the InChIKey of 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one?
The InChIKey is VTKJFIWYSUBHNP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H10ClNO2/c2*13-4-7-1-2-8-9-5-16-6-10(9)12(15)14-11(8)3-7/h2*1-3H,4-6H2,(H,14,15).
What are the key properties of 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one?
7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one has a molecular weight of 471.34 g/mol, XLogP of 4.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(chloromethyl)-3,5-dihydro-1H-furo[3,4-c]quinolin-4-one is sourced from PubChem (CID 171614035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).