C10H16FNO — CID 171614098
[(2R,8R)-6-ethylidene-2-fluoro-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol (PubChem CID 171614098) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is [(2R,8R)-6-ethylidene-2-fluoro-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol.
| Compound Name | [(2R,8R)-6-ethylidene-2-fluoro-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol |
|---|---|
| PubChem CID | 171614098 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | [(2R,8R)-6-ethylidene-2-fluoro-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl]methanol |
| SMILES | CC=C1CN2C[C@H](F)C[C@@]2(CO)C1 |
| InChI | InChI=1S/C10H16FNO/c1-2-8-3-10(7-13)4-9(11)6-12(10)5-8/h2,9,13H,3-7H2,1H3/t9-,10-/m1/s1 |
| InChIKey | PZEAUWJPGFVUQK-NXEZZACHSA-N |
| XLogP | 1.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|