C27H36FN5O7S2 — CID 171614395
2-(dimethylamino)ethyl-[3-[2-(2-fluorophenyl)-4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]pyrrol-1-yl]sulfonylanilino]sulfamic acid (PubChem CID 171614395) has the molecular formula C27H36FN5O7S2 and a molecular weight of 625.75 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl-[3-[2-(2-fluorophenyl)-4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]pyrrol-1-yl]sulfonylanilino]sulfamic acid.
| Compound Name | 2-(dimethylamino)ethyl-[3-[2-(2-fluorophenyl)-4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]pyrrol-1-yl]sulfonylanilino]sulfamic acid |
|---|---|
| PubChem CID | 171614395 |
| Molecular Formula | C27H36FN5O7S2 |
| Molecular Weight | 625.75 g/mol |
| Exact Mass | 625.20 |
| IUPAC Name | 2-(dimethylamino)ethyl-[3-[2-(2-fluorophenyl)-4-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]pyrrol-1-yl]sulfonylanilino]sulfamic acid |
| SMILES | CN(C)CCN(Nc1cccc(S(=O)(=O)n2cc(CN(C)C(=O)OC(C)(C)C)cc2-c2ccccc2F)c1)S(=O)(=O)O |
| InChI | InChI=1S/C27H36FN5O7S2/c1-27(2,3)40-26(34)31(6)18-20-16-25(23-12-7-8-13-24(23)28)32(19-20)41(35,36)22-11-9-10-21(17-22)29-33(42(37,38)39)15-14-30(4)5/h7-13,16-17,19,29H,14-15,18H2,1-6H3,(H,37,38,39) |
| InChIKey | NOMANDWUDYONJH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.75 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|