C21H38ClNO — CID 171616615
benzyl-(7-hydroxydodecyl)-dimethylazanium chloride (PubChem CID 171616615) has the molecular formula C21H38ClNO and a molecular weight of 355.99 g/mol. Its IUPAC name is benzyl-(7-hydroxydodecyl)-dimethylazanium chloride.
| Compound Name | benzyl-(7-hydroxydodecyl)-dimethylazanium chloride |
|---|---|
| PubChem CID | 171616615 |
| Molecular Formula | C21H38ClNO |
| Molecular Weight | 355.99 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | benzyl-(7-hydroxydodecyl)-dimethylazanium chloride |
| SMILES | CCCCCC(O)CCCCCC[N+](C)(C)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H38NO.ClH/c1-4-5-9-16-21(23)17-12-6-7-13-18-22(2,3)19-20-14-10-8-11-15-20;/h8,10-11,14-15,21,23H,4-7,9,12-13,16-19H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | DEXAPPFVMRXAHY-UHFFFAOYSA-M |
| XLogP | 2.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.99 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|