C21H25NO3 — CID 17161663
N-(3-butan-2-yloxyphenyl)-3-(2-methylprop-2-enoxy)benzamide (PubChem CID 17161663) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-(3-butan-2-yloxyphenyl)-3-(2-methylprop-2-enoxy)benzamide.
| Compound Name | N-(3-butan-2-yloxyphenyl)-3-(2-methylprop-2-enoxy)benzamide |
|---|---|
| PubChem CID | 17161663 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-(3-butan-2-yloxyphenyl)-3-(2-methylprop-2-enoxy)benzamide |
| SMILES | C=C(C)COc1cccc(C(=O)Nc2cccc(OC(C)CC)c2)c1 |
| InChI | InChI=1S/C21H25NO3/c1-5-16(4)25-20-11-7-9-18(13-20)22-21(23)17-8-6-10-19(12-17)24-14-15(2)3/h6-13,16H,2,5,14H2,1,3-4H3,(H,22,23) |
| InChIKey | NVKISADBINQPDV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|