C22H32N4O4S — CID 171616659
2-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]butyl]-4-(2-methylpropyl)-1,2,4-thiadiazolidine-3,5-dione (PubChem CID 171616659) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]butyl]-4-(2-methylpropyl)-1,2,4-thiadiazolidine-3,5-dione.
| Compound Name | 2-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]butyl]-4-(2-methylpropyl)-1,2,4-thiadiazolidine-3,5-dione |
|---|---|
| PubChem CID | 171616659 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-[4-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]butyl]-4-(2-methylpropyl)-1,2,4-thiadiazolidine-3,5-dione |
| SMILES | CC(C)Cn1c(=O)sn(CCCCN2CCN(Cc3ccc4c(c3)OCO4)CC2)c1=O |
| InChI | InChI=1S/C22H32N4O4S/c1-17(2)14-25-21(27)26(31-22(25)28)8-4-3-7-23-9-11-24(12-10-23)15-18-5-6-19-20(13-18)30-16-29-19/h5-6,13,17H,3-4,7-12,14-16H2,1-2H3 |
| InChIKey | UAEKWODVIWLKSG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 68.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|