C14H15ClF2O3 — CID 171617217
[6-(4-chlorophenoxy)-1,1-difluorohex-1-en-3-yl] acetate (PubChem CID 171617217) has the molecular formula C14H15ClF2O3 and a molecular weight of 304.72 g/mol. Its IUPAC name is [6-(4-chlorophenoxy)-1,1-difluorohex-1-en-3-yl] acetate.
| Compound Name | [6-(4-chlorophenoxy)-1,1-difluorohex-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 171617217 |
| Molecular Formula | C14H15ClF2O3 |
| Molecular Weight | 304.72 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | [6-(4-chlorophenoxy)-1,1-difluorohex-1-en-3-yl] acetate |
| SMILES | CC(=O)OC(C=C(F)F)CCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H15ClF2O3/c1-10(18)20-13(9-14(16)17)3-2-8-19-12-6-4-11(15)5-7-12/h4-7,9,13H,2-3,8H2,1H3 |
| InChIKey | GSIZHKYSRWBFBW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.72 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|