C30H29N5O2 — CID 171617397
N-[4-[4-amino-7-cyano-3-(4-cyclohexyloxyphenyl)-1-methylpyrrolo[3,2-c]pyridin-2-yl]phenyl]prop-2-enamide (PubChem CID 171617397) has the molecular formula C30H29N5O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is N-[4-[4-amino-7-cyano-3-(4-cyclohexyloxyphenyl)-1-methylpyrrolo[3,2-c]pyridin-2-yl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[4-amino-7-cyano-3-(4-cyclohexyloxyphenyl)-1-methylpyrrolo[3,2-c]pyridin-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 171617397 |
| Molecular Formula | C30H29N5O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | N-[4-[4-amino-7-cyano-3-(4-cyclohexyloxyphenyl)-1-methylpyrrolo[3,2-c]pyridin-2-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(-c2c(-c3ccc(OC4CCCCC4)cc3)c3c(N)ncc(C#N)c3n2C)cc1 |
| InChI | InChI=1S/C30H29N5O2/c1-3-25(36)34-22-13-9-20(10-14-22)28-26(27-29(35(28)2)21(17-31)18-33-30(27)32)19-11-15-24(16-12-19)37-23-7-5-4-6-8-23/h3,9-16,18,23H,1,4-8H2,2H3,(H2,32,33)(H,34,36) |
| InChIKey | ICYYNPQDDFOYQP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|