C27H27F3N8O3 — CID 171617519
4-[4-amino-6-[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 171617519) has the molecular formula C27H27F3N8O3 and a molecular weight of 568.56 g/mol. Its IUPAC name is 4-[4-amino-6-[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[4-amino-6-[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 171617519 |
| Molecular Formula | C27H27F3N8O3 |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | 4-[4-amino-6-[4-[[(E)-4-(dimethylamino)but-2-enoyl]amino]phenyl]pyrazolo[5,1-f][1,2,4]triazin-5-yl]-2-methoxy-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | COc1cc(-c2c(-c3ccc(NC(=O)/C=C/CN(C)C)cc3)nn3ncnc(N)c23)ccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C27H27F3N8O3/c1-37(2)12-4-5-21(39)35-18-9-6-16(7-10-18)23-22(24-25(31)33-15-34-38(24)36-23)17-8-11-19(20(13-17)41-3)26(40)32-14-27(28,29)30/h4-11,13,15H,12,14H2,1-3H3,(H,32,40)(H,35,39)(H2,31,33,34)/b5-4+ |
| InChIKey | HUEMIANXVVTZFS-SNAWJCMRSA-N |
| XLogP | 3.40 |
| TPSA | 139.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|