About disodium;2,2-di(octanoyl)-3-sulfobutanedioate
disodium;2,2-di(octanoyl)-3-sulfobutanedioate (PubChem CID 171617879) has the molecular formula C20H32Na2O9S
and a molecular weight of 494.51 g/mol. Its IUPAC name is disodium;2,2-di(octanoyl)-3-sulfobutanedioate.
Molecular Properties
| Compound Name | disodium;2,2-di(octanoyl)-3-sulfobutanedioate |
| PubChem CID | 171617879 |
| Molecular Formula | C20H32Na2O9S |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | disodium;2,2-di(octanoyl)-3-sulfobutanedioate |
| SMILES | CCCCCCCC(=O)C(C(=O)[O-])(C(=O)CCCCCCC)C(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C20H34O9S.2Na/c1-3-5-7-9-11-13-15(21)20(19(25)26,17(18(23)24)30(27,28)29)16(22)14-12-10-8-6-4-2;;/h17H,3-14H2,1-2H3,(H,23,24)(H,25,26)(H,27,28,29);;/q;2*+1/p-2 |
| InChIKey | QYJHHWTYRIRHGN-UHFFFAOYSA-L |
| XLogP | -5.40 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | -5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;2,2-di(octanoyl)-3-sulfobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2,2-di(octanoyl)-3-sulfobutanedioate?
The IUPAC name of disodium;2,2-di(octanoyl)-3-sulfobutanedioate (CID 171617879) is disodium;2,2-di(octanoyl)-3-sulfobutanedioate.
What is the SMILES notation for disodium;2,2-di(octanoyl)-3-sulfobutanedioate?
The canonical SMILES for disodium;2,2-di(octanoyl)-3-sulfobutanedioate is CCCCCCCC(=O)C(C(=O)[O-])(C(=O)CCCCCCC)C(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+].
What is the InChIKey of disodium;2,2-di(octanoyl)-3-sulfobutanedioate?
The InChIKey is QYJHHWTYRIRHGN-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H34O9S.2Na/c1-3-5-7-9-11-13-15(21)20(19(25)26,17(18(23)24)30(27,28)29)16(22)14-12-10-8-6-4-2;;/h17H,3-14H2,1-2H3,(H,23,24)(H,25,26)(H,27,28,29);;/q;2*+1/p-2.
What are the key properties of disodium;2,2-di(octanoyl)-3-sulfobutanedioate?
disodium;2,2-di(octanoyl)-3-sulfobutanedioate has a molecular weight of 494.51 g/mol, XLogP of -5.40, 18 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2,2-di(octanoyl)-3-sulfobutanedioate is sourced from PubChem (CID 171617879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).