About methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride
methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride (PubChem CID 171618153) has the molecular formula C18H23ClNO3P
and a molecular weight of 367.81 g/mol. Its IUPAC name is methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride |
| PubChem CID | 171618153 |
| Molecular Formula | C18H23ClNO3P |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride |
| SMILES | COC(=O)C(C)C(N)CP(=O)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C18H22NO3P.ClH/c1-14(18(20)22-2)17(19)13-23(21,15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12,14,17H,13,19H2,1-2H3;1H |
| InChIKey | SCBUBGDFICOJHO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride?
The IUPAC name of methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride (CID 171618153) is methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride.
What is the SMILES notation for methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride?
The canonical SMILES for methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride is COC(=O)C(C)C(N)CP(=O)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride?
The InChIKey is SCBUBGDFICOJHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22NO3P.ClH/c1-14(18(20)22-2)17(19)13-23(21,15-9-5-3-6-10-15)16-11-7-4-8-12-16;/h3-12,14,17H,13,19H2,1-2H3;1H.
What are the key properties of methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride?
methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride has a molecular weight of 367.81 g/mol, XLogP of 2.56, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-4-diphenylphosphoryl-2-methylbutanoate;hydrochloride is sourced from PubChem (CID 171618153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).