C18H34O2 — CID 171618429
(1R,3aR,7aR)-1-[(2S)-6-hydroxy-6-methylheptan-2-yl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ol (PubChem CID 171618429) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is (1R,3aR,7aR)-1-[(2S)-6-hydroxy-6-methylheptan-2-yl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ol.
| Compound Name | (1R,3aR,7aR)-1-[(2S)-6-hydroxy-6-methylheptan-2-yl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 171618429 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | (1R,3aR,7aR)-1-[(2S)-6-hydroxy-6-methylheptan-2-yl]-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ol |
| SMILES | CC1CCC(O)[C@@H]2CC[C@H]([C@@H](C)CCCC(C)(C)O)[C@@H]12 |
| InChI | InChI=1S/C18H34O2/c1-12(6-5-11-18(3,4)20)14-8-9-15-16(19)10-7-13(2)17(14)15/h12-17,19-20H,5-11H2,1-4H3/t12-,13?,14+,15-,16?,17+/m0/s1 |
| InChIKey | JOEKPWUKVSKHNH-FKKQLSJUSA-N |
| XLogP | 4.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |