C11H7F10NS — CID 171618815
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(2,2,2-trifluoroethylsulfanyl)aniline (PubChem CID 171618815) has the molecular formula C11H7F10NS and a molecular weight of 375.23 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(2,2,2-trifluoroethylsulfanyl)aniline.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(2,2,2-trifluoroethylsulfanyl)aniline |
|---|---|
| PubChem CID | 171618815 |
| Molecular Formula | C11H7F10NS |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(2,2,2-trifluoroethylsulfanyl)aniline |
| SMILES | Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1SCC(F)(F)F |
| InChI | InChI=1S/C11H7F10NS/c12-8(13,14)4-23-7-3-5(1-2-6(7)22)9(15,10(16,17)18)11(19,20)21/h1-3H,4,22H2 |
| InChIKey | NQIWSOLNNQJETD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|