C17H29N3O3 — CID 171619171
N-[2-(dimethylamino)ethyl]-2-(4-methylphenoxy)acetamide;pyrrolidin-3-ol (PubChem CID 171619171) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-(4-methylphenoxy)acetamide;pyrrolidin-3-ol.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-(4-methylphenoxy)acetamide;pyrrolidin-3-ol |
|---|---|
| PubChem CID | 171619171 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-(4-methylphenoxy)acetamide;pyrrolidin-3-ol |
| SMILES | Cc1ccc(OCC(=O)NCCN(C)C)cc1.OC1CCNC1 |
| InChI | InChI=1S/C13H20N2O2.C4H9NO/c1-11-4-6-12(7-5-11)17-10-13(16)14-8-9-15(2)3;6-4-1-2-5-3-4/h4-7H,8-10H2,1-3H3,(H,14,16);4-6H,1-3H2 |
| InChIKey | JKVKDGHOFZWJGZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |