C23H19ClF2N5O7P — CID 171619341
[6-chloro-3-[(Z)-[1-[1-(4-cyano-3-fluorophenyl)-2-hydroxy-2-(2-hydroxyethylamino)ethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-7-fluoroindol-1-yl]phosphonic acid (PubChem CID 171619341) has the molecular formula C23H19ClF2N5O7P and a molecular weight of 581.86 g/mol. Its IUPAC name is [6-chloro-3-[(Z)-[1-[1-(4-cyano-3-fluorophenyl)-2-hydroxy-2-(2-hydroxyethylamino)ethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-7-fluoroindol-1-yl]phosphonic acid.
| Compound Name | [6-chloro-3-[(Z)-[1-[1-(4-cyano-3-fluorophenyl)-2-hydroxy-2-(2-hydroxyethylamino)ethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-7-fluoroindol-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 171619341 |
| Molecular Formula | C23H19ClF2N5O7P |
| Molecular Weight | 581.86 g/mol |
| Exact Mass | 581.07 |
| IUPAC Name | [6-chloro-3-[(Z)-[1-[1-(4-cyano-3-fluorophenyl)-2-hydroxy-2-(2-hydroxyethylamino)ethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-7-fluoroindol-1-yl]phosphonic acid |
| SMILES | N#Cc1ccc(C(C(O)NCCO)N2C(=O)N/C(=C\c3cn(P(=O)(O)O)c4c(F)c(Cl)ccc34)C2=O)cc1F |
| InChI | InChI=1S/C23H19ClF2N5O7P/c24-15-4-3-14-13(10-30(39(36,37)38)20(14)18(15)26)8-17-22(34)31(23(35)29-17)19(21(33)28-5-6-32)11-1-2-12(9-27)16(25)7-11/h1-4,7-8,10,19,21,28,32-33H,5-6H2,(H,29,35)(H2,36,37,38)/b17-8- |
| InChIKey | WRLGOXICNISOKD-IUXPMGMMSA-N |
| XLogP | 1.92 |
| TPSA | 188.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.86 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|