C20H18F2N2O — CID 171619585
(3S)-5-[6-(difluoromethyl)-5-ethynyl-3-pyridinyl]-2,2,3-trimethyl-3H-1,4-benzoxazepine (PubChem CID 171619585) has the molecular formula C20H18F2N2O and a molecular weight of 340.37 g/mol. Its IUPAC name is (3S)-5-[6-(difluoromethyl)-5-ethynyl-3-pyridinyl]-2,2,3-trimethyl-3H-1,4-benzoxazepine.
| Compound Name | (3S)-5-[6-(difluoromethyl)-5-ethynyl-3-pyridinyl]-2,2,3-trimethyl-3H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 171619585 |
| Molecular Formula | C20H18F2N2O |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (3S)-5-[6-(difluoromethyl)-5-ethynyl-3-pyridinyl]-2,2,3-trimethyl-3H-1,4-benzoxazepine |
| SMILES | C#Cc1cc(C2=N[C@@H](C)C(C)(C)Oc3ccccc32)cnc1C(F)F |
| InChI | InChI=1S/C20H18F2N2O/c1-5-13-10-14(11-23-18(13)19(21)22)17-15-8-6-7-9-16(15)25-20(3,4)12(2)24-17/h1,6-12,19H,2-4H3/t12-/m0/s1 |
| InChIKey | QLFLNHFZFAOFBA-LBPRGKRZSA-N |
| XLogP | 4.40 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|