C6H10O8 — CID 171620318
(5S)-5-(1,2-dihydroxyethyl)-3,3,4,4-tetrahydroxyoxolan-2-one (PubChem CID 171620318) has the molecular formula C6H10O8 and a molecular weight of 210.14 g/mol. Its IUPAC name is (5S)-5-(1,2-dihydroxyethyl)-3,3,4,4-tetrahydroxyoxolan-2-one.
| Compound Name | (5S)-5-(1,2-dihydroxyethyl)-3,3,4,4-tetrahydroxyoxolan-2-one |
|---|---|
| PubChem CID | 171620318 |
| Molecular Formula | C6H10O8 |
| Molecular Weight | 210.14 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | (5S)-5-(1,2-dihydroxyethyl)-3,3,4,4-tetrahydroxyoxolan-2-one |
| SMILES | O=C1O[C@@H](C(O)CO)C(O)(O)C1(O)O |
| InChI | InChI=1S/C6H10O8/c7-1-2(8)3-5(10,11)6(12,13)4(9)14-3/h2-3,7-8,10-13H,1H2/t2?,3-/m0/s1 |
| InChIKey | XGWYJUFLMSTPDO-NFJMKROFSA-N |
| XLogP | -4.37 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.14 |
| LogP ≤ 5 | -4.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|