C15H24Cl2N2O — CID 171620410
N-[(2-chloro-6-ethoxyphenyl)methyl]-1-piperidin-4-ylmethanamine;hydrochloride (PubChem CID 171620410) has the molecular formula C15H24Cl2N2O and a molecular weight of 319.28 g/mol. Its IUPAC name is N-[(2-chloro-6-ethoxyphenyl)methyl]-1-piperidin-4-ylmethanamine;hydrochloride.
| Compound Name | N-[(2-chloro-6-ethoxyphenyl)methyl]-1-piperidin-4-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171620410 |
| Molecular Formula | C15H24Cl2N2O |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-[(2-chloro-6-ethoxyphenyl)methyl]-1-piperidin-4-ylmethanamine;hydrochloride |
| SMILES | CCOc1cccc(Cl)c1CNCC1CCNCC1.Cl |
| InChI | InChI=1S/C15H23ClN2O.ClH/c1-2-19-15-5-3-4-14(16)13(15)11-18-10-12-6-8-17-9-7-12;/h3-5,12,17-18H,2,6-11H2,1H3;1H |
| InChIKey | XFRYOKQCMWZPSU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |