C8H14O6 — CID 171620819
2-(methoxymethyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine-6,7-diol (PubChem CID 171620819) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is 2-(methoxymethyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine-6,7-diol.
| Compound Name | 2-(methoxymethyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine-6,7-diol |
|---|---|
| PubChem CID | 171620819 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-(methoxymethyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine-6,7-diol |
| SMILES | COCC1OCC2OC(O)C(O)C2O1 |
| InChI | InChI=1S/C8H14O6/c1-11-3-5-12-2-4-7(14-5)6(9)8(10)13-4/h4-10H,2-3H2,1H3 |
| InChIKey | UNSDWXSCCLVKHK-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |