C14H20N2O — CID 171622300
(9aS)-8-(4-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 171622300) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is (9aS)-8-(4-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (9aS)-8-(4-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 171622300 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (9aS)-8-(4-methylphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | Cc1ccc(N2CCN3CCOC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C14H20N2O/c1-12-2-4-13(5-3-12)16-7-6-15-8-9-17-11-14(15)10-16/h2-5,14H,6-11H2,1H3/t14-/m0/s1 |
| InChIKey | GASSYIWYNXPASV-AWEZNQCLSA-N |
| XLogP | 1.52 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|