About 2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine
2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 171622746) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine.
Analyze 2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine?
The IUPAC name of 2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine (CID 171622746) is 2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine.
What is the SMILES notation for 2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine?
The canonical SMILES for 2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine is Cc1cncc2c1OC(C)CN2.
What is the InChIKey of 2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine?
The InChIKey is XGNQPGLCXLVWPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-6-3-10-5-8-9(6)12-7(2)4-11-8/h3,5,7,11H,4H2,1-2H3.
What are the key properties of 2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine?
2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine has a molecular weight of 164.21 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-dimethyl-3,4-dihydro-2H-pyrido[4,3-b][1,4]oxazine is sourced from PubChem (CID 171622746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).