C22H28N6O3 — CID 171622770
4-[(4-hydroxycyclohexyl)amino]-2-[4-(4-methylpiperazin-1-yl)phenyl]-[1,2]oxazolo[5,4-d]pyrimidin-3-one (PubChem CID 171622770) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is 4-[(4-hydroxycyclohexyl)amino]-2-[4-(4-methylpiperazin-1-yl)phenyl]-[1,2]oxazolo[5,4-d]pyrimidin-3-one.
| Compound Name | 4-[(4-hydroxycyclohexyl)amino]-2-[4-(4-methylpiperazin-1-yl)phenyl]-[1,2]oxazolo[5,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 171622770 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 4-[(4-hydroxycyclohexyl)amino]-2-[4-(4-methylpiperazin-1-yl)phenyl]-[1,2]oxazolo[5,4-d]pyrimidin-3-one |
| SMILES | CN1CCN(c2ccc(-n3oc4ncnc(NC5CCC(O)CC5)c4c3=O)cc2)CC1 |
| InChI | InChI=1S/C22H28N6O3/c1-26-10-12-27(13-11-26)16-4-6-17(7-5-16)28-22(30)19-20(23-14-24-21(19)31-28)25-15-2-8-18(29)9-3-15/h4-7,14-15,18,29H,2-3,8-13H2,1H3,(H,23,24,25) |
| InChIKey | ALVFNMBBLUKYRA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|