C24H31NO3 — CID 171623351
3-methylpentanoic acid;1-phenyl-2-[[(E)-2-phenylprop-1-enyl]amino]propan-1-one (PubChem CID 171623351) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-methylpentanoic acid;1-phenyl-2-[[(E)-2-phenylprop-1-enyl]amino]propan-1-one.
| Compound Name | 3-methylpentanoic acid;1-phenyl-2-[[(E)-2-phenylprop-1-enyl]amino]propan-1-one |
|---|---|
| PubChem CID | 171623351 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 3-methylpentanoic acid;1-phenyl-2-[[(E)-2-phenylprop-1-enyl]amino]propan-1-one |
| SMILES | C/C(=C\NC(C)C(=O)c1ccccc1)c1ccccc1.CCC(C)CC(=O)O |
| InChI | InChI=1S/C18H19NO.C6H12O2/c1-14(16-9-5-3-6-10-16)13-19-15(2)18(20)17-11-7-4-8-12-17;1-3-5(2)4-6(7)8/h3-13,15,19H,1-2H3;5H,3-4H2,1-2H3,(H,7,8)/b14-13+; |
| InChIKey | IVGORNWZZWGPRE-IERUDJENSA-N |
| XLogP | 5.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |