About 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium
4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium (PubChem CID 171623632) has the molecular formula C13H16N2O3S
and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium |
| PubChem CID | 171623632 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium |
| SMILES | C=CC[n+]1cc[nH]c1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C7H8O3S.C6H8N2/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-8-5-3-7-6-8/h2-5H,1H3,(H,8,9,10);2-3,5-6H,1,4H2 |
| InChIKey | WANRFSKKZSHVAG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium?
The IUPAC name of 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium (CID 171623632) is 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium.
What is the SMILES notation for 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium?
The canonical SMILES for 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium is C=CC[n+]1cc[nH]c1.Cc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium?
The InChIKey is WANRFSKKZSHVAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C6H8N2/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-4-8-5-3-7-6-8/h2-5H,1H3,(H,8,9,10);2-3,5-6H,1,4H2.
What are the key properties of 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium?
4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium has a molecular weight of 280.35 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonate;3-prop-2-enyl-1H-imidazol-3-ium is sourced from PubChem (CID 171623632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).