About ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine
ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine (PubChem CID 171623926) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine.
Molecular Properties
| Compound Name | ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine |
| PubChem CID | 171623926 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine |
| SMILES | CC.CNCNCc1ccnc(C)c1 |
| InChI | InChI=1S/C9H15N3.C2H6/c1-8-5-9(3-4-12-8)6-11-7-10-2;1-2/h3-5,10-11H,6-7H2,1-2H3;1-2H3 |
| InChIKey | ZLAJMTDRRIJEOJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine?
The IUPAC name of ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine (CID 171623926) is ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine.
What is the SMILES notation for ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine?
The canonical SMILES for ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine is CC.CNCNCc1ccnc(C)c1.
What is the InChIKey of ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine?
The InChIKey is ZLAJMTDRRIJEOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3.C2H6/c1-8-5-9(3-4-12-8)6-11-7-10-2;1-2/h3-5,10-11H,6-7H2,1-2H3;1-2H3.
What are the key properties of ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine?
ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine has a molecular weight of 195.31 g/mol, XLogP of 1.68, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-N'-[(2-methyl-4-pyridinyl)methyl]methanediamine is sourced from PubChem (CID 171623926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).