C30H37F2N7O — CID 171624517
(1S,9S)-N-[4-(4,4-difluoropiperidin-1-yl)phenyl]-1,11,11-trimethyl-8-[6-(methylaminomethyl)-2-pyridinyl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine (PubChem CID 171624517) has the molecular formula C30H37F2N7O and a molecular weight of 549.67 g/mol. Its IUPAC name is (1S,9S)-N-[4-(4,4-difluoropiperidin-1-yl)phenyl]-1,11,11-trimethyl-8-[6-(methylaminomethyl)-2-pyridinyl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine.
| Compound Name | (1S,9S)-N-[4-(4,4-difluoropiperidin-1-yl)phenyl]-1,11,11-trimethyl-8-[6-(methylaminomethyl)-2-pyridinyl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine |
|---|---|
| PubChem CID | 171624517 |
| Molecular Formula | C30H37F2N7O |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | (1S,9S)-N-[4-(4,4-difluoropiperidin-1-yl)phenyl]-1,11,11-trimethyl-8-[6-(methylaminomethyl)-2-pyridinyl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine |
| SMILES | CNCc1cccc(N2c3nc(Nc4ccc(N5CCC(F)(F)CC5)cc4)ncc3[C@]3(C)COC(C)(C)C[C@H]23)n1 |
| InChI | InChI=1S/C30H37F2N7O/c1-28(2)16-24-29(3,19-40-28)23-18-34-27(37-26(23)39(24)25-7-5-6-21(35-25)17-33-4)36-20-8-10-22(11-9-20)38-14-12-30(31,32)13-15-38/h5-11,18,24,33H,12-17,19H2,1-4H3,(H,34,36,37)/t24-,29-/m0/s1 |
| InChIKey | IPNFMKWFWGJLOT-OUTSHDOLSA-N |
| XLogP | 5.55 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|