About tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate
tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate (PubChem CID 171624749) has the molecular formula C12H14BrF3N2O2
and a molecular weight of 355.15 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate |
| PubChem CID | 171624749 |
| Molecular Formula | C12H14BrF3N2O2 |
| Molecular Weight | 355.15 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](c1cccc(Br)n1)C(F)(F)F |
| InChI | InChI=1S/C12H14BrF3N2O2/c1-11(2,3)20-10(19)18-9(12(14,15)16)7-5-4-6-8(13)17-7/h4-6,9H,1-3H3,(H,18,19)/t9-/m1/s1 |
| InChIKey | ZOTNZQFMXSKNEJ-SECBINFHSA-N |
| XLogP | 3.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.15 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate?
The IUPAC name of tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate (CID 171624749) is tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate?
The canonical SMILES for tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate is CC(C)(C)OC(=O)N[C@H](c1cccc(Br)n1)C(F)(F)F.
What is the InChIKey of tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate?
The InChIKey is ZOTNZQFMXSKNEJ-SECBINFHSA-N. The full InChI is InChI=1S/C12H14BrF3N2O2/c1-11(2,3)20-10(19)18-9(12(14,15)16)7-5-4-6-8(13)17-7/h4-6,9H,1-3H3,(H,18,19)/t9-/m1/s1.
What are the key properties of tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate?
tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate has a molecular weight of 355.15 g/mol, XLogP of 3.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethyl]carbamate is sourced from PubChem (CID 171624749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).