C16H16N6O2 — CID 171625494
(5S)-N-(5-methoxypyrimidin-2-yl)-5-methyl-1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-8-carboxamide (PubChem CID 171625494) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is (5S)-N-(5-methoxypyrimidin-2-yl)-5-methyl-1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-8-carboxamide.
| Compound Name | (5S)-N-(5-methoxypyrimidin-2-yl)-5-methyl-1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 171625494 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (5S)-N-(5-methoxypyrimidin-2-yl)-5-methyl-1,10,11-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-8-carboxamide |
| SMILES | COc1cnc(NC(=O)c2cc3c(n4cnnc24)CC[C@@H]3C)nc1 |
| InChI | InChI=1S/C16H16N6O2/c1-9-3-4-13-11(9)5-12(14-21-19-8-22(13)14)15(23)20-16-17-6-10(24-2)7-18-16/h5-9H,3-4H2,1-2H3,(H,17,18,20,23)/t9-/m0/s1 |
| InChIKey | HXSGXFYRYANAIF-VIFPVBQESA-N |
| XLogP | 1.83 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |