About (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane
(NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane (PubChem CID 171625948) has the molecular formula C12H20BrN3O
and a molecular weight of 302.22 g/mol. Its IUPAC name is (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane.
Molecular Properties
| Compound Name | (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane |
| PubChem CID | 171625948 |
| Molecular Formula | C12H20BrN3O |
| Molecular Weight | 302.22 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane |
| SMILES | C.CC.CC(/C=N/O)=N\Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C9H10BrN3O.C2H6.CH4/c1-7(6-11-14)12-13-9-4-2-8(10)3-5-9;1-2;/h2-6,13-14H,1H3;1-2H3;1H4/b11-6+,12-7+;; |
| InChIKey | ZCXTWEURJMDJPQ-YTSWEKPFSA-N |
| XLogP | 4.36 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.22 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane?
The IUPAC name of (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane (CID 171625948) is (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane.
What is the SMILES notation for (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane?
The canonical SMILES for (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane is C.CC.CC(/C=N/O)=N\Nc1ccc(Br)cc1.
What is the InChIKey of (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane?
The InChIKey is ZCXTWEURJMDJPQ-YTSWEKPFSA-N. The full InChI is InChI=1S/C9H10BrN3O.C2H6.CH4/c1-7(6-11-14)12-13-9-4-2-8(10)3-5-9;1-2;/h2-6,13-14H,1H3;1-2H3;1H4/b11-6+,12-7+;;.
What are the key properties of (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane?
(NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane has a molecular weight of 302.22 g/mol, XLogP of 4.36, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[(2E)-2-[(4-bromophenyl)hydrazinylidene]propylidene]hydroxylamine;ethane;methane is sourced from PubChem (CID 171625948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).