About (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine
(Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine (PubChem CID 171626416) has the molecular formula C8H17N3
and a molecular weight of 155.24 g/mol. Its IUPAC name is (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine.
Molecular Properties
| Compound Name | (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine |
| PubChem CID | 171626416 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine |
| SMILES | C/N=C(C)/C(=C(/C)N)C(C)N |
| InChI | InChI=1S/C8H17N3/c1-5(9)8(6(2)10)7(3)11-4/h5H,9-10H2,1-4H3/b8-6-,11-7+ |
| InChIKey | ITMGKCLVSHYYMW-FAWHLJIPSA-N |
| XLogP | 0.66 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine?
The IUPAC name of (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine (CID 171626416) is (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine.
What is the SMILES notation for (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine?
The canonical SMILES for (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine is C/N=C(C)/C(=C(/C)N)C(C)N.
What is the InChIKey of (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine?
The InChIKey is ITMGKCLVSHYYMW-FAWHLJIPSA-N. The full InChI is InChI=1S/C8H17N3/c1-5(9)8(6(2)10)7(3)11-4/h5H,9-10H2,1-4H3/b8-6-,11-7+.
What are the key properties of (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine?
(Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine has a molecular weight of 155.24 g/mol, XLogP of 0.66, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(C,N-dimethylcarbonimidoyl)pent-2-ene-2,4-diamine is sourced from PubChem (CID 171626416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).