About N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine
N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine (PubChem CID 171627138) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine.
Molecular Properties
| Compound Name | N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine |
| PubChem CID | 171627138 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine |
| SMILES | C=C/C=C(\N=C\C)C1CCNC1 |
| InChI | InChI=1S/C10H16N2/c1-3-5-10(12-4-2)9-6-7-11-8-9/h3-5,9,11H,1,6-8H2,2H3/b10-5-,12-4+ |
| InChIKey | CQRLWHFIAQAKCX-LZCVDSOTSA-N |
| XLogP | 1.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine?
The IUPAC name of N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine (CID 171627138) is N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine.
What is the SMILES notation for N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine?
The canonical SMILES for N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine is C=C/C=C(\N=C\C)C1CCNC1.
What is the InChIKey of N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine?
The InChIKey is CQRLWHFIAQAKCX-LZCVDSOTSA-N. The full InChI is InChI=1S/C10H16N2/c1-3-5-10(12-4-2)9-6-7-11-8-9/h3-5,9,11H,1,6-8H2,2H3/b10-5-,12-4+.
What are the key properties of N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine?
N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine has a molecular weight of 164.25 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-1-pyrrolidin-3-ylbuta-1,3-dienyl]ethanimine is sourced from PubChem (CID 171627138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).