About ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one
ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one (PubChem CID 171627448) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one.
Molecular Properties
| Compound Name | ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one |
| PubChem CID | 171627448 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one |
| SMILES | C=C/C=C1/CN(C)C(=O)/C1=C/C.CC.CC.CC |
| InChI | InChI=1S/C10H13NO.3C2H6/c1-4-6-8-7-11(3)10(12)9(8)5-2;3*1-2/h4-6H,1,7H2,2-3H3;3*1-2H3/b8-6-,9-5+;;; |
| InChIKey | QPLHQGYLLUSUDK-VNIHKQLQSA-N |
| XLogP | 4.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one?
The IUPAC name of ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one (CID 171627448) is ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one.
What is the SMILES notation for ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one?
The canonical SMILES for ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one is C=C/C=C1/CN(C)C(=O)/C1=C/C.CC.CC.CC.
What is the InChIKey of ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one?
The InChIKey is QPLHQGYLLUSUDK-VNIHKQLQSA-N. The full InChI is InChI=1S/C10H13NO.3C2H6/c1-4-6-8-7-11(3)10(12)9(8)5-2;3*1-2/h4-6H,1,7H2,2-3H3;3*1-2H3/b8-6-,9-5+;;;.
What are the key properties of ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one?
ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one has a molecular weight of 253.43 g/mol, XLogP of 4.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3E,4E)-3-ethylidene-1-methyl-4-prop-2-enylidenepyrrolidin-2-one is sourced from PubChem (CID 171627448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).