C26H27ClF3N5O3 — CID 171627851
(2R)-N-[(3S,4S)-4-(3-chlorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide (PubChem CID 171627851) has the molecular formula C26H27ClF3N5O3 and a molecular weight of 549.98 g/mol. Its IUPAC name is (2R)-N-[(3S,4S)-4-(3-chlorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide.
| Compound Name | (2R)-N-[(3S,4S)-4-(3-chlorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
|---|---|
| PubChem CID | 171627851 |
| Molecular Formula | C26H27ClF3N5O3 |
| Molecular Weight | 549.98 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | (2R)-N-[(3S,4S)-4-(3-chlorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
| SMILES | CC(C)[C@@H](NC(=O)C(F)(F)F)C(=O)N[C@@H]1CN(C(=O)c2cccn3cncc23)CC[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H27ClF3N5O3/c1-15(2)22(33-25(38)26(28,29)30)23(36)32-20-13-34(10-8-18(20)16-5-3-6-17(27)11-16)24(37)19-7-4-9-35-14-31-12-21(19)35/h3-7,9,11-12,14-15,18,20,22H,8,10,13H2,1-2H3,(H,32,36)(H,33,38)/t18-,20+,22+/m0/s1 |
| InChIKey | AIMHCPLEGXIVPR-CZTZKLFOSA-N |
| XLogP | 3.81 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.98 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |