About ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene
ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene (PubChem CID 171627853) has the molecular formula C14H29N3O
and a molecular weight of 255.41 g/mol. Its IUPAC name is ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene.
Molecular Properties
| Compound Name | ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene |
| PubChem CID | 171627853 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene |
| SMILES | C/N=C(\C)C(=O)N[C@H]1CCCNC1.C=CC.CC |
| InChI | InChI=1S/C9H17N3O.C3H6.C2H6/c1-7(10-2)9(13)12-8-4-3-5-11-6-8;1-3-2;1-2/h8,11H,3-6H2,1-2H3,(H,12,13);3H,1H2,2H3;1-2H3/b10-7+;;/t8-;;/m0../s1 |
| InChIKey | FOHHSVPVLQVYJO-YBXLTCMBSA-N |
| XLogP | 2.16 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene?
The IUPAC name of ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene (CID 171627853) is ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene.
What is the SMILES notation for ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene?
The canonical SMILES for ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene is C/N=C(\C)C(=O)N[C@H]1CCCNC1.C=CC.CC.
What is the InChIKey of ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene?
The InChIKey is FOHHSVPVLQVYJO-YBXLTCMBSA-N. The full InChI is InChI=1S/C9H17N3O.C3H6.C2H6/c1-7(10-2)9(13)12-8-4-3-5-11-6-8;1-3-2;1-2/h8,11H,3-6H2,1-2H3,(H,12,13);3H,1H2,2H3;1-2H3/b10-7+;;/t8-;;/m0../s1.
What are the key properties of ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene?
ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene has a molecular weight of 255.41 g/mol, XLogP of 2.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylimino-N-[(3S)-piperidin-3-yl]propanamide;prop-1-ene is sourced from PubChem (CID 171627853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).