C27H27N5O3 — CID 171627859
N-[(3S,4S)-1-(imidazo[1,5-a]pyridine-8-carbonyl)-4-phenylpiperidin-3-yl]-1,4,6,7-tetrahydropyrano[4,3-b]pyrrole-2-carboxamide (PubChem CID 171627859) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is N-[(3S,4S)-1-(imidazo[1,5-a]pyridine-8-carbonyl)-4-phenylpiperidin-3-yl]-1,4,6,7-tetrahydropyrano[4,3-b]pyrrole-2-carboxamide.
| Compound Name | N-[(3S,4S)-1-(imidazo[1,5-a]pyridine-8-carbonyl)-4-phenylpiperidin-3-yl]-1,4,6,7-tetrahydropyrano[4,3-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 171627859 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-[(3S,4S)-1-(imidazo[1,5-a]pyridine-8-carbonyl)-4-phenylpiperidin-3-yl]-1,4,6,7-tetrahydropyrano[4,3-b]pyrrole-2-carboxamide |
| SMILES | O=C(N[C@@H]1CN(C(=O)c2cccn3cncc23)CC[C@H]1c1ccccc1)c1cc2c([nH]1)CCOC2 |
| InChI | InChI=1S/C27H27N5O3/c33-26(23-13-19-16-35-12-9-22(19)29-23)30-24-15-31(11-8-20(24)18-5-2-1-3-6-18)27(34)21-7-4-10-32-17-28-14-25(21)32/h1-7,10,13-14,17,20,24,29H,8-9,11-12,15-16H2,(H,30,33)/t20-,24+/m0/s1 |
| InChIKey | HZXNJOJCZOSJTF-GBXCKJPGSA-N |
| XLogP | 3.16 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |