C26H26ClF4N5O3 — CID 171627890
(2R)-N-[(3S,4S)-4-(3-chloro-4-fluorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide (PubChem CID 171627890) has the molecular formula C26H26ClF4N5O3 and a molecular weight of 567.97 g/mol. Its IUPAC name is (2R)-N-[(3S,4S)-4-(3-chloro-4-fluorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide.
| Compound Name | (2R)-N-[(3S,4S)-4-(3-chloro-4-fluorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
|---|---|
| PubChem CID | 171627890 |
| Molecular Formula | C26H26ClF4N5O3 |
| Molecular Weight | 567.97 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | (2R)-N-[(3S,4S)-4-(3-chloro-4-fluorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
| SMILES | CC(C)[C@@H](NC(=O)C(F)(F)F)C(=O)N[C@@H]1CN(C(=O)c2cccn3cncc23)CC[C@H]1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C26H26ClF4N5O3/c1-14(2)22(34-25(39)26(29,30)31)23(37)33-20-12-35(9-7-16(20)15-5-6-19(28)18(27)10-15)24(38)17-4-3-8-36-13-32-11-21(17)36/h3-6,8,10-11,13-14,16,20,22H,7,9,12H2,1-2H3,(H,33,37)(H,34,39)/t16-,20+,22+/m0/s1 |
| InChIKey | POBJNXDTJKXHLL-SAWYMBPVSA-N |
| XLogP | 3.94 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.97 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |