C28H28ClF4N5O3 — CID 171628005
N-[(3S,4S)-4-(3-chloro-5-fluorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-1-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxamide (PubChem CID 171628005) has the molecular formula C28H28ClF4N5O3 and a molecular weight of 594.01 g/mol. Its IUPAC name is N-[(3S,4S)-4-(3-chloro-5-fluorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-1-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxamide.
| Compound Name | N-[(3S,4S)-4-(3-chloro-5-fluorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-1-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 171628005 |
| Molecular Formula | C28H28ClF4N5O3 |
| Molecular Weight | 594.01 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | N-[(3S,4S)-4-(3-chloro-5-fluorophenyl)-1-(imidazo[1,5-a]pyridine-8-carbonyl)piperidin-3-yl]-1-[(2,2,2-trifluoroacetyl)amino]cyclohexane-1-carboxamide |
| SMILES | O=C(c1cccn2cncc12)N1CC[C@@H](c2cc(F)cc(Cl)c2)[C@H](NC(=O)C2(NC(=O)C(F)(F)F)CCCCC2)C1 |
| InChI | InChI=1S/C28H28ClF4N5O3/c29-18-11-17(12-19(30)13-18)20-6-10-37(24(39)21-5-4-9-38-16-34-14-23(21)38)15-22(20)35-25(40)27(7-2-1-3-8-27)36-26(41)28(31,32)33/h4-5,9,11-14,16,20,22H,1-3,6-8,10,15H2,(H,35,40)(H,36,41)/t20-,22+/m0/s1 |
| InChIKey | JEGADOKGZXVBRN-RBBKRZOGSA-N |
| XLogP | 4.62 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.01 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |