About ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium
ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium (PubChem CID 171628303) has the molecular formula C10H15N2+
and a molecular weight of 163.24 g/mol. Its IUPAC name is ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium.
Molecular Properties
| Compound Name | ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium |
| PubChem CID | 171628303 |
| Molecular Formula | C10H15N2+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium |
| SMILES | CC.CC1=CC=CC2C=NC=[N+]12 |
| InChI | InChI=1S/C8H9N2.C2H6/c1-7-3-2-4-8-5-9-6-10(7)8;1-2/h2-6,8H,1H3;1-2H3/q+1; |
| InChIKey | SYTVUXBKZUAXIN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium?
The IUPAC name of ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium (CID 171628303) is ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium.
What is the SMILES notation for ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium?
The canonical SMILES for ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium is CC.CC1=CC=CC2C=NC=[N+]12.
What is the InChIKey of ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium?
The InChIKey is SYTVUXBKZUAXIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N2.C2H6/c1-7-3-2-4-8-5-9-6-10(7)8;1-2/h2-6,8H,1H3;1-2H3/q+1;.
What are the key properties of ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium?
ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium has a molecular weight of 163.24 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-8aH-imidazo[1,5-a]pyridin-4-ium is sourced from PubChem (CID 171628303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).