About N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate
N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate (PubChem CID 171628416) has the molecular formula C13H24N2O3
and a molecular weight of 256.35 g/mol. Its IUPAC name is N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate.
Molecular Properties
| Compound Name | N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate |
| PubChem CID | 171628416 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate |
| SMILES | CCNC(=O)C=C(C)C.CNC/C=C/C(=O)OC |
| InChI | InChI=1S/C7H13NO.C6H11NO2/c1-4-8-7(9)5-6(2)3;1-7-5-3-4-6(8)9-2/h5H,4H2,1-3H3,(H,8,9);3-4,7H,5H2,1-2H3/b;4-3+ |
| InChIKey | NECZEAFRARRYDP-SCBDLNNBSA-N |
| XLogP | 1.02 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate?
The IUPAC name of N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate (CID 171628416) is N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate.
What is the SMILES notation for N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate?
The canonical SMILES for N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate is CCNC(=O)C=C(C)C.CNC/C=C/C(=O)OC.
What is the InChIKey of N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate?
The InChIKey is NECZEAFRARRYDP-SCBDLNNBSA-N. The full InChI is InChI=1S/C7H13NO.C6H11NO2/c1-4-8-7(9)5-6(2)3;1-7-5-3-4-6(8)9-2/h5H,4H2,1-3H3,(H,8,9);3-4,7H,5H2,1-2H3/b;4-3+.
What are the key properties of N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate?
N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate has a molecular weight of 256.35 g/mol, XLogP of 1.02, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-methylbut-2-enamide;methyl (E)-4-(methylamino)but-2-enoate is sourced from PubChem (CID 171628416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).