C23H44N2O+2 — CID 171628645
1,5-bis(1-methyl-1-prop-2-enylpiperidin-1-ium-2-yl)pentan-3-ol (PubChem CID 171628645) has the molecular formula C23H44N2O+2 and a molecular weight of 364.62 g/mol. Its IUPAC name is 1,5-bis(1-methyl-1-prop-2-enylpiperidin-1-ium-2-yl)pentan-3-ol.
| Compound Name | 1,5-bis(1-methyl-1-prop-2-enylpiperidin-1-ium-2-yl)pentan-3-ol |
|---|---|
| PubChem CID | 171628645 |
| Molecular Formula | C23H44N2O+2 |
| Molecular Weight | 364.62 g/mol |
| Exact Mass | 364.34 |
| IUPAC Name | 1,5-bis(1-methyl-1-prop-2-enylpiperidin-1-ium-2-yl)pentan-3-ol |
| SMILES | C=CC[N+]1(C)CCCCC1CCC(O)CCC1CCCC[N+]1(C)CC=C |
| InChI | InChI=1S/C23H44N2O/c1-5-17-24(3)19-9-7-11-21(24)13-15-23(26)16-14-22-12-8-10-20-25(22,4)18-6-2/h5-6,21-23,26H,1-2,7-20H2,3-4H3/q+2 |
| InChIKey | OBCULLFEBFOMFG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|