About 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine
9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine (PubChem CID 171628998) has the molecular formula C10H11FN4O2
and a molecular weight of 238.22 g/mol. Its IUPAC name is 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine.
Molecular Properties
| Compound Name | 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine |
| PubChem CID | 171628998 |
| Molecular Formula | C10H11FN4O2 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine |
| SMILES | COc1ncnc2c1NCN2C1OC=CC1F |
| InChI | InChI=1S/C10H11FN4O2/c1-16-9-7-8(12-4-13-9)15(5-14-7)10-6(11)2-3-17-10/h2-4,6,10,14H,5H2,1H3 |
| InChIKey | IHBNRYATYCUFPN-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine?
The IUPAC name of 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine (CID 171628998) is 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine.
What is the SMILES notation for 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine?
The canonical SMILES for 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine is COc1ncnc2c1NCN2C1OC=CC1F.
What is the InChIKey of 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine?
The InChIKey is IHBNRYATYCUFPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN4O2/c1-16-9-7-8(12-4-13-9)15(5-14-7)10-6(11)2-3-17-10/h2-4,6,10,14H,5H2,1H3.
What are the key properties of 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine?
9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine has a molecular weight of 238.22 g/mol, XLogP of 0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3-fluoro-2,3-dihydrofuran-2-yl)-6-methoxy-7,8-dihydropurine is sourced from PubChem (CID 171628998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).