C28H33F2N5O2Si — CID 171630076
2-[[8-(2,6-difluorophenyl)-13-(3,6-dihydro-2H-pyran-4-yl)-5,11-dimethyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630076) has the molecular formula C28H33F2N5O2Si and a molecular weight of 537.69 g/mol. Its IUPAC name is 2-[[8-(2,6-difluorophenyl)-13-(3,6-dihydro-2H-pyran-4-yl)-5,11-dimethyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[8-(2,6-difluorophenyl)-13-(3,6-dihydro-2H-pyran-4-yl)-5,11-dimethyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630076 |
| Molecular Formula | C28H33F2N5O2Si |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 2-[[8-(2,6-difluorophenyl)-13-(3,6-dihydro-2H-pyran-4-yl)-5,11-dimethyl-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nc(C2=CCOCC2)cc2c1N=C(c1c(F)cccc1F)Nc1c(C)nn(COCC[Si](C)(C)C)c1-2 |
| InChI | InChI=1S/C28H33F2N5O2Si/c1-17-25-20(15-23(31-17)19-9-11-36-12-10-19)27-26(18(2)34-35(27)16-37-13-14-38(3,4)5)33-28(32-25)24-21(29)7-6-8-22(24)30/h6-9,15H,10-14,16H2,1-5H3,(H,32,33) |
| InChIKey | HDQXMOBUSZZZLM-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|