C23H23ClF5N5OSi — CID 171630113
2-[[13-chloro-8-(2,6-difluorophenyl)-5-methyl-11-(trifluoromethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630113) has the molecular formula C23H23ClF5N5OSi and a molecular weight of 544.00 g/mol. Its IUPAC name is 2-[[13-chloro-8-(2,6-difluorophenyl)-5-methyl-11-(trifluoromethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[13-chloro-8-(2,6-difluorophenyl)-5-methyl-11-(trifluoromethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630113 |
| Molecular Formula | C23H23ClF5N5OSi |
| Molecular Weight | 544.00 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 2-[[13-chloro-8-(2,6-difluorophenyl)-5-methyl-11-(trifluoromethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,8,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c2c1NC(c1c(F)cccc1F)=Nc1c-2cc(Cl)nc1C(F)(F)F |
| InChI | InChI=1S/C23H23ClF5N5OSi/c1-12-18-20(34(33-12)11-35-8-9-36(2,3)4)13-10-16(24)30-21(23(27,28)29)19(13)32-22(31-18)17-14(25)6-5-7-15(17)26/h5-7,10H,8-9,11H2,1-4H3,(H,31,32) |
| InChIKey | QTMNVOBAFQFVTC-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.00 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|