C24H26ClF2N5OSi — CID 171630166
2-[[14-chloro-8-(2,6-difluorophenyl)-5-methyl-3,4,7,9,13-pentazatetracyclo[7.6.1.02,6.012,16]hexadeca-1(15),2(6),4,7,12(16),13-hexaen-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630166) has the molecular formula C24H26ClF2N5OSi and a molecular weight of 502.04 g/mol. Its IUPAC name is 2-[[14-chloro-8-(2,6-difluorophenyl)-5-methyl-3,4,7,9,13-pentazatetracyclo[7.6.1.02,6.012,16]hexadeca-1(15),2(6),4,7,12(16),13-hexaen-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[14-chloro-8-(2,6-difluorophenyl)-5-methyl-3,4,7,9,13-pentazatetracyclo[7.6.1.02,6.012,16]hexadeca-1(15),2(6),4,7,12(16),13-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630166 |
| Molecular Formula | C24H26ClF2N5OSi |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | 2-[[14-chloro-8-(2,6-difluorophenyl)-5-methyl-3,4,7,9,13-pentazatetracyclo[7.6.1.02,6.012,16]hexadeca-1(15),2(6),4,7,12(16),13-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c2c1N=C(c1c(F)cccc1F)N1CCc3nc(Cl)cc-2c31 |
| InChI | InChI=1S/C24H26ClF2N5OSi/c1-14-21-23(32(30-14)13-33-10-11-34(2,3)4)15-12-19(25)28-18-8-9-31(22(15)18)24(29-21)20-16(26)6-5-7-17(20)27/h5-7,12H,8-11,13H2,1-4H3 |
| InChIKey | IMNSGJYITBIIDT-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|