C23H24ClF2N5O3Si — CID 171630187
methyl 13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaene-5-carboxylate (PubChem CID 171630187) has the molecular formula C23H24ClF2N5O3Si and a molecular weight of 520.01 g/mol. Its IUPAC name is methyl 13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaene-5-carboxylate.
| Compound Name | methyl 13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 171630187 |
| Molecular Formula | C23H24ClF2N5O3Si |
| Molecular Weight | 520.01 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | methyl 13-chloro-8-(2,6-difluorophenyl)-3-(2-trimethylsilylethoxymethyl)-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaene-5-carboxylate |
| SMILES | COC(=O)c1nn(COCC[Si](C)(C)C)c2c1N=C(c1c(F)cccc1F)Nc1cnc(Cl)cc1-2 |
| InChI | InChI=1S/C23H24ClF2N5O3Si/c1-33-23(32)20-19-21(31(30-20)12-34-8-9-35(2,3)4)13-10-17(24)27-11-16(13)28-22(29-19)18-14(25)6-5-7-15(18)26/h5-7,10-11H,8-9,12H2,1-4H3,(H,28,29) |
| InChIKey | UVMNEYAVSGQQPT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.01 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|