C26H26F5N7OSi — CID 171630200
2-[[8-(2,6-difluorophenyl)-5-methyl-13-[3-(trifluoromethyl)pyrazol-1-yl]-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630200) has the molecular formula C26H26F5N7OSi and a molecular weight of 575.62 g/mol. Its IUPAC name is 2-[[8-(2,6-difluorophenyl)-5-methyl-13-[3-(trifluoromethyl)pyrazol-1-yl]-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[8-(2,6-difluorophenyl)-5-methyl-13-[3-(trifluoromethyl)pyrazol-1-yl]-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630200 |
| Molecular Formula | C26H26F5N7OSi |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 2-[[8-(2,6-difluorophenyl)-5-methyl-13-[3-(trifluoromethyl)pyrazol-1-yl]-3,4,7,9,12-pentazatricyclo[8.4.0.02,6]tetradeca-1(14),2(6),4,7,10,12-hexaen-3-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c2c1N=C(c1c(F)cccc1F)Nc1cnc(-n3ccc(C(F)(F)F)n3)cc1-2 |
| InChI | InChI=1S/C26H26F5N7OSi/c1-15-23-24(38(35-15)14-39-10-11-40(2,3)4)16-12-21(37-9-8-20(36-37)26(29,30)31)32-13-19(16)33-25(34-23)22-17(27)6-5-7-18(22)28/h5-9,12-13H,10-11,14H2,1-4H3,(H,33,34) |
| InChIKey | LQPFKZUVXHWESM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|